About 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid
4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid (PubChem CID 67776623) has the molecular formula C25H23FO2
and a molecular weight of 374.46 g/mol. Its IUPAC name is 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid |
| PubChem CID | 67776623 |
| Molecular Formula | C25H23FO2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid |
| SMILES | Cc1ccc(CC(/C=C/c2ccc(C(=O)O)cc2)c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C25H23FO2/c1-17-6-7-20(14-18(17)2)15-23(22-4-3-5-24(26)16-22)13-10-19-8-11-21(12-9-19)25(27)28/h3-14,16,23H,15H2,1-2H3,(H,27,28)/b13-10+ |
| InChIKey | BJJKLDMKYQYLRK-JLHYYAGUSA-N |
| XLogP | 6.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid?
The IUPAC name of 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid (CID 67776623) is 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid.
What is the SMILES notation for 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid?
The canonical SMILES for 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid is Cc1ccc(CC(/C=C/c2ccc(C(=O)O)cc2)c2cccc(F)c2)cc1C.
What is the InChIKey of 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid?
The InChIKey is BJJKLDMKYQYLRK-JLHYYAGUSA-N. The full InChI is InChI=1S/C25H23FO2/c1-17-6-7-20(14-18(17)2)15-23(22-4-3-5-24(26)16-22)13-10-19-8-11-21(12-9-19)25(27)28/h3-14,16,23H,15H2,1-2H3,(H,27,28)/b13-10+.
What are the key properties of 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid?
4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid has a molecular weight of 374.46 g/mol, XLogP of 6.18, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-enyl]benzoic acid is sourced from PubChem (CID 67776623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).