C22H16F2O4 — CID 69410777
3-[1,2-bis(3-fluorophenyl)ethoxycarbonyl]benzoic acid (PubChem CID 69410777) has the molecular formula C22H16F2O4 and a molecular weight of 382.36 g/mol. Its IUPAC name is 3-[1,2-bis(3-fluorophenyl)ethoxycarbonyl]benzoic acid.
| Compound Name | 3-[1,2-bis(3-fluorophenyl)ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 69410777 |
| Molecular Formula | C22H16F2O4 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 3-[1,2-bis(3-fluorophenyl)ethoxycarbonyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C(=O)OC(Cc2cccc(F)c2)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C22H16F2O4/c23-18-8-1-4-14(10-18)11-20(15-5-3-9-19(24)13-15)28-22(27)17-7-2-6-16(12-17)21(25)26/h1-10,12-13,20H,11H2,(H,25,26) |
| InChIKey | CLEWZGQJGKAMNW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |