C29H31NO3 — CID 138632241
3-hydroxy-6-[[3-methyl-4-[2-(2-methyl-3-phenylphenyl)ethynyl]phenyl]methylamino]hexanoic acid (PubChem CID 138632241) has the molecular formula C29H31NO3 and a molecular weight of 441.57 g/mol. Its IUPAC name is 3-hydroxy-6-[[3-methyl-4-[2-(2-methyl-3-phenylphenyl)ethynyl]phenyl]methylamino]hexanoic acid.
| Compound Name | 3-hydroxy-6-[[3-methyl-4-[2-(2-methyl-3-phenylphenyl)ethynyl]phenyl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 138632241 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 3-hydroxy-6-[[3-methyl-4-[2-(2-methyl-3-phenylphenyl)ethynyl]phenyl]methylamino]hexanoic acid |
| SMILES | Cc1cc(CNCCCC(O)CC(=O)O)ccc1C#Cc1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C29H31NO3/c1-21-18-23(20-30-17-7-11-27(31)19-29(32)33)13-14-24(21)15-16-25-10-6-12-28(22(25)2)26-8-4-3-5-9-26/h3-6,8-10,12-14,18,27,30-31H,7,11,17,19-20H2,1-2H3,(H,32,33) |
| InChIKey | UPNKLPPPKUVQSX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|