C29H29NO3 — CID 138606914
3-hydroxy-1-[[3-methyl-4-[2-(2-methyl-3-phenylphenyl)ethynyl]phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 138606914) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 3-hydroxy-1-[[3-methyl-4-[2-(2-methyl-3-phenylphenyl)ethynyl]phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | 3-hydroxy-1-[[3-methyl-4-[2-(2-methyl-3-phenylphenyl)ethynyl]phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 138606914 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-hydroxy-1-[[3-methyl-4-[2-(2-methyl-3-phenylphenyl)ethynyl]phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cc(CN2CCCC(O)C2C(=O)O)ccc1C#Cc1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C29H29NO3/c1-20-18-22(19-30-17-7-12-27(31)28(30)29(32)33)13-14-23(20)15-16-24-10-6-11-26(21(24)2)25-8-4-3-5-9-25/h3-6,8-11,13-14,18,27-28,31H,7,12,17,19H2,1-2H3,(H,32,33) |
| InChIKey | QKZYEISFAXERPT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|