C26H27NO3 — CID 138632273
(2R)-3-hydroxy-2-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propanoic acid (PubChem CID 138632273) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 138632273 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (2R)-3-hydroxy-2-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propanoic acid |
| SMILES | Cc1cc(CN[C@H](CO)C(=O)O)ccc1/C=C/c1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C26H27NO3/c1-18-15-20(16-27-25(17-28)26(29)30)11-12-21(18)13-14-22-9-6-10-24(19(22)2)23-7-4-3-5-8-23/h3-15,25,27-28H,16-17H2,1-2H3,(H,29,30)/b14-13+/t25-/m1/s1 |
| InChIKey | DECMZYUSTZYIIJ-AKNQKSQZSA-N |
| XLogP | 4.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|