C22H37NO3 — CID 59994992
4-[(2,6-dimethyl-4-nonylphenyl)methylamino]-3-hydroxybutanoic acid (PubChem CID 59994992) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 4-[(2,6-dimethyl-4-nonylphenyl)methylamino]-3-hydroxybutanoic acid.
| Compound Name | 4-[(2,6-dimethyl-4-nonylphenyl)methylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 59994992 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 4-[(2,6-dimethyl-4-nonylphenyl)methylamino]-3-hydroxybutanoic acid |
| SMILES | CCCCCCCCCc1cc(C)c(CNCC(O)CC(=O)O)c(C)c1 |
| InChI | InChI=1S/C22H37NO3/c1-4-5-6-7-8-9-10-11-19-12-17(2)21(18(3)13-19)16-23-15-20(24)14-22(25)26/h12-13,20,23-24H,4-11,14-16H2,1-3H3,(H,25,26) |
| InChIKey | VSKDFXNGVGQIPV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|