C12H18NO5P — CID 67255747
3-(3-methylphenyl)-2-(2-phosphonoethylamino)propanoic acid (PubChem CID 67255747) has the molecular formula C12H18NO5P and a molecular weight of 287.25 g/mol. Its IUPAC name is 3-(3-methylphenyl)-2-(2-phosphonoethylamino)propanoic acid.
| Compound Name | 3-(3-methylphenyl)-2-(2-phosphonoethylamino)propanoic acid |
|---|---|
| PubChem CID | 67255747 |
| Molecular Formula | C12H18NO5P |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-(3-methylphenyl)-2-(2-phosphonoethylamino)propanoic acid |
| SMILES | Cc1cccc(CC(NCCP(=O)(O)O)C(=O)O)c1 |
| InChI | InChI=1S/C12H18NO5P/c1-9-3-2-4-10(7-9)8-11(12(14)15)13-5-6-19(16,17)18/h2-4,7,11,13H,5-6,8H2,1H3,(H,14,15)(H2,16,17,18) |
| InChIKey | JBRNDTKZRIZOBP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|