C27H29ClO4 — CID 90330910
methyl 4-[4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)-5-hydroxypentoxy]benzoate (PubChem CID 90330910) has the molecular formula C27H29ClO4 and a molecular weight of 452.98 g/mol. Its IUPAC name is methyl 4-[4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)-5-hydroxypentoxy]benzoate.
| Compound Name | methyl 4-[4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)-5-hydroxypentoxy]benzoate |
|---|---|
| PubChem CID | 90330910 |
| Molecular Formula | C27H29ClO4 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | methyl 4-[4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)-5-hydroxypentoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCC(c2cccc(Cl)c2)C(O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C27H29ClO4/c1-18-9-10-22(16-19(18)2)26(29)25(21-6-4-7-23(28)17-21)8-5-15-32-24-13-11-20(12-14-24)27(30)31-3/h4,6-7,9-14,16-17,25-26,29H,5,8,15H2,1-3H3 |
| InChIKey | YJOVPFYHTRVSSR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|