C17H16Cl2O3 — CID 67999647
4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-hydroxypentanoic acid (PubChem CID 67999647) has the molecular formula C17H16Cl2O3 and a molecular weight of 339.22 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-hydroxypentanoic acid.
| Compound Name | 4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-hydroxypentanoic acid |
|---|---|
| PubChem CID | 67999647 |
| Molecular Formula | C17H16Cl2O3 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-hydroxypentanoic acid |
| SMILES | O=C(O)CCC(c1cccc(Cl)c1)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2O3/c18-13-6-4-11(5-7-13)17(22)15(8-9-16(20)21)12-2-1-3-14(19)10-12/h1-7,10,15,17,22H,8-9H2,(H,20,21) |
| InChIKey | XWNCEINYSURNRS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |