C17H15Cl2N3O2 — CID 141326905
5-azido-4-(3-chlorophenyl)-5-(4-chlorophenyl)pentanoic acid (PubChem CID 141326905) has the molecular formula C17H15Cl2N3O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is 5-azido-4-(3-chlorophenyl)-5-(4-chlorophenyl)pentanoic acid.
| Compound Name | 5-azido-4-(3-chlorophenyl)-5-(4-chlorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 141326905 |
| Molecular Formula | C17H15Cl2N3O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 5-azido-4-(3-chlorophenyl)-5-(4-chlorophenyl)pentanoic acid |
| SMILES | [N-]=[N+]=NC(c1ccc(Cl)cc1)C(CCC(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N3O2/c18-13-6-4-11(5-7-13)17(21-22-20)15(8-9-16(23)24)12-2-1-3-14(19)10-12/h1-7,10,15,17H,8-9H2,(H,23,24) |
| InChIKey | MURSRPJJNQGKNQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|