C20H24Cl2N2O2 — CID 129154293
(4R,5S)-5-amino-4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)pentanoic acid (PubChem CID 129154293) has the molecular formula C20H24Cl2N2O2 and a molecular weight of 395.33 g/mol. Its IUPAC name is (4R,5S)-5-amino-4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)pentanoic acid.
| Compound Name | (4R,5S)-5-amino-4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 129154293 |
| Molecular Formula | C20H24Cl2N2O2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (4R,5S)-5-amino-4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)pentanoic acid |
| SMILES | CC(C)N[C@](N)(c1ccc(Cl)cc1)[C@H](CCC(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H24Cl2N2O2/c1-13(2)24-20(23,15-6-8-16(21)9-7-15)18(10-11-19(25)26)14-4-3-5-17(22)12-14/h3-9,12-13,18,24H,10-11,23H2,1-2H3,(H,25,26)/t18-,20-/m1/s1 |
| InChIKey | KBGNXCSQKRRQMX-UYAOXDASSA-N |
| XLogP | 4.75 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|