C20H22ClNO3 — CID 120547125
4-[2-(3-chlorophenyl)propanoylamino]-5-phenylpentanoic acid (PubChem CID 120547125) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)propanoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[2-(3-chlorophenyl)propanoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120547125 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[2-(3-chlorophenyl)propanoylamino]-5-phenylpentanoic acid |
| SMILES | CC(C(=O)NC(CCC(=O)O)Cc1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClNO3/c1-14(16-8-5-9-17(21)13-16)20(25)22-18(10-11-19(23)24)12-15-6-3-2-4-7-15/h2-9,13-14,18H,10-12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | WWGUBDDKRSKZGA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |