C20H24N2O4 — CID 122011972
4-[[(1S)-1-(3-hydroxyphenyl)ethyl]carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122011972) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-[[(1S)-1-(3-hydroxyphenyl)ethyl]carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[(1S)-1-(3-hydroxyphenyl)ethyl]carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122011972 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-[[(1S)-1-(3-hydroxyphenyl)ethyl]carbamoylamino]-5-phenylpentanoic acid |
| SMILES | C[C@H](NC(=O)NC(CCC(=O)O)Cc1ccccc1)c1cccc(O)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-14(16-8-5-9-18(23)13-16)21-20(26)22-17(10-11-19(24)25)12-15-6-3-2-4-7-15/h2-9,13-14,17,23H,10-12H2,1H3,(H,24,25)(H2,21,22,26)/t14-,17?/m0/s1 |
| InChIKey | WZTJMJDMMWCTGY-MBIQTGHCSA-N |
| XLogP | 3.23 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |