C22H27N3O4 — CID 122075451
4-[[3-(2-methylpropanoylamino)phenyl]carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122075451) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-[[3-(2-methylpropanoylamino)phenyl]carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[3-(2-methylpropanoylamino)phenyl]carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122075451 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-[[3-(2-methylpropanoylamino)phenyl]carbamoylamino]-5-phenylpentanoic acid |
| SMILES | CC(C)C(=O)Nc1cccc(NC(=O)NC(CCC(=O)O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H27N3O4/c1-15(2)21(28)23-17-9-6-10-18(14-17)24-22(29)25-19(11-12-20(26)27)13-16-7-4-3-5-8-16/h3-10,14-15,19H,11-13H2,1-2H3,(H,23,28)(H,26,27)(H2,24,25,29) |
| InChIKey | QQMLLXCVPHYBLK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |