C19H21FN2O4S — CID 122085643
4-[(3-fluoro-4-methylsulfinylphenyl)carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122085643) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is 4-[(3-fluoro-4-methylsulfinylphenyl)carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(3-fluoro-4-methylsulfinylphenyl)carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122085643 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-[(3-fluoro-4-methylsulfinylphenyl)carbamoylamino]-5-phenylpentanoic acid |
| SMILES | CS(=O)c1ccc(NC(=O)NC(CCC(=O)O)Cc2ccccc2)cc1F |
| InChI | InChI=1S/C19H21FN2O4S/c1-27(26)17-9-7-15(12-16(17)20)22-19(25)21-14(8-10-18(23)24)11-13-5-3-2-4-6-13/h2-7,9,12,14H,8,10-11H2,1H3,(H,23,24)(H2,21,22,25) |
| InChIKey | MBJQRACQLSTSNU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |