C20H24N2O3S — CID 122088884
4-[(2-methyl-5-methylsulfanylphenyl)carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122088884) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-[(2-methyl-5-methylsulfanylphenyl)carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(2-methyl-5-methylsulfanylphenyl)carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122088884 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-[(2-methyl-5-methylsulfanylphenyl)carbamoylamino]-5-phenylpentanoic acid |
| SMILES | CSc1ccc(C)c(NC(=O)NC(CCC(=O)O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H24N2O3S/c1-14-8-10-17(26-2)13-18(14)22-20(25)21-16(9-11-19(23)24)12-15-6-4-3-5-7-15/h3-8,10,13,16H,9,11-12H2,1-2H3,(H,23,24)(H2,21,22,25) |
| InChIKey | SSCRRMQQSSPYPM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |