C19H21N3O5 — CID 122088999
4-[(3-methyl-4-nitrophenyl)carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122088999) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-[(3-methyl-4-nitrophenyl)carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(3-methyl-4-nitrophenyl)carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122088999 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[(3-methyl-4-nitrophenyl)carbamoylamino]-5-phenylpentanoic acid |
| SMILES | Cc1cc(NC(=O)NC(CCC(=O)O)Cc2ccccc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N3O5/c1-13-11-15(7-9-17(13)22(26)27)20-19(25)21-16(8-10-18(23)24)12-14-5-3-2-4-6-14/h2-7,9,11,16H,8,10,12H2,1H3,(H,23,24)(H2,20,21,25) |
| InChIKey | ZSVJSSIIVQJSFZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|