C20H22F2N2O3 — CID 122090873
4-[[3-(1,1-difluoroethyl)phenyl]carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122090873) has the molecular formula C20H22F2N2O3 and a molecular weight of 376.40 g/mol. Its IUPAC name is 4-[[3-(1,1-difluoroethyl)phenyl]carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[3-(1,1-difluoroethyl)phenyl]carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122090873 |
| Molecular Formula | C20H22F2N2O3 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-[[3-(1,1-difluoroethyl)phenyl]carbamoylamino]-5-phenylpentanoic acid |
| SMILES | CC(F)(F)c1cccc(NC(=O)NC(CCC(=O)O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H22F2N2O3/c1-20(21,22)15-8-5-9-16(13-15)23-19(27)24-17(10-11-18(25)26)12-14-6-3-2-4-7-14/h2-9,13,17H,10-12H2,1H3,(H,25,26)(H2,23,24,27) |
| InChIKey | UANYYVVWOSIJPZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |