C20H21F3N2O3 — CID 122085886
5-phenyl-4-[[3-(2,2,2-trifluoroethyl)phenyl]carbamoylamino]pentanoic acid (PubChem CID 122085886) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is 5-phenyl-4-[[3-(2,2,2-trifluoroethyl)phenyl]carbamoylamino]pentanoic acid.
| Compound Name | 5-phenyl-4-[[3-(2,2,2-trifluoroethyl)phenyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122085886 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 5-phenyl-4-[[3-(2,2,2-trifluoroethyl)phenyl]carbamoylamino]pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)Nc1cccc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N2O3/c21-20(22,23)13-15-7-4-8-16(12-15)24-19(28)25-17(9-10-18(26)27)11-14-5-2-1-3-6-14/h1-8,12,17H,9-11,13H2,(H,26,27)(H2,24,25,28) |
| InChIKey | VGNMBJXORBZZEV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |