C18H18F3N3O4 — CID 122077457
4-[[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122077457) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is 4-[[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122077457 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-[[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]carbamoylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C18H18F3N3O4/c19-18(20,21)12-9-14(16(27)22-10-12)24-17(28)23-13(6-7-15(25)26)8-11-4-2-1-3-5-11/h1-5,9-10,13H,6-8H2,(H,22,27)(H,25,26)(H2,23,24,28) |
| InChIKey | XTYKVAQKZLCRTE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |