C22H28N2O4 — CID 122093496
4-[(4-methoxy-2,3,6-trimethylphenyl)carbamoylamino]-5-phenylpentanoic acid (PubChem CID 122093496) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[(4-methoxy-2,3,6-trimethylphenyl)carbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(4-methoxy-2,3,6-trimethylphenyl)carbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122093496 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[(4-methoxy-2,3,6-trimethylphenyl)carbamoylamino]-5-phenylpentanoic acid |
| SMILES | COc1cc(C)c(NC(=O)NC(CCC(=O)O)Cc2ccccc2)c(C)c1C |
| InChI | InChI=1S/C22H28N2O4/c1-14-12-19(28-4)15(2)16(3)21(14)24-22(27)23-18(10-11-20(25)26)13-17-8-6-5-7-9-17/h5-9,12,18H,10-11,13H2,1-4H3,(H,25,26)(H2,23,24,27) |
| InChIKey | FRYFINHTJRVLCO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |