C25H26N2O3 — CID 69428404
methyl 5-phenyl-4-[(4-phenylphenyl)carbamoylamino]pentanoate (PubChem CID 69428404) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl 5-phenyl-4-[(4-phenylphenyl)carbamoylamino]pentanoate.
| Compound Name | methyl 5-phenyl-4-[(4-phenylphenyl)carbamoylamino]pentanoate |
|---|---|
| PubChem CID | 69428404 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | methyl 5-phenyl-4-[(4-phenylphenyl)carbamoylamino]pentanoate |
| SMILES | COC(=O)CCC(Cc1ccccc1)NC(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O3/c1-30-24(28)17-16-23(18-19-8-4-2-5-9-19)27-25(29)26-22-14-12-21(13-15-22)20-10-6-3-7-11-20/h2-15,23H,16-18H2,1H3,(H2,26,27,29) |
| InChIKey | FSPSKXANDKZVHT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |