C18H23N3O3 — CID 122111365
4-[2-(2-methylpyrazol-3-yl)propanoylamino]-5-phenylpentanoic acid (PubChem CID 122111365) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-[2-(2-methylpyrazol-3-yl)propanoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[2-(2-methylpyrazol-3-yl)propanoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122111365 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-[2-(2-methylpyrazol-3-yl)propanoylamino]-5-phenylpentanoic acid |
| SMILES | CC(C(=O)NC(CCC(=O)O)Cc1ccccc1)c1ccnn1C |
| InChI | InChI=1S/C18H23N3O3/c1-13(16-10-11-19-21(16)2)18(24)20-15(8-9-17(22)23)12-14-6-4-3-5-7-14/h3-7,10-11,13,15H,8-9,12H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | LPJPGICHYHVTPE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |