C21H27Cl2NO — CID 76834428
4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)hexan-1-ol (PubChem CID 76834428) has the molecular formula C21H27Cl2NO and a molecular weight of 380.36 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)hexan-1-ol.
| Compound Name | 4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)hexan-1-ol |
|---|---|
| PubChem CID | 76834428 |
| Molecular Formula | C21H27Cl2NO |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)hexan-1-ol |
| SMILES | CC(C)NC(C)(c1ccc(Cl)cc1)C(CCCO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H27Cl2NO/c1-15(2)24-21(3,17-9-11-18(22)12-10-17)20(8-5-13-25)16-6-4-7-19(23)14-16/h4,6-7,9-12,14-15,20,24-25H,5,8,13H2,1-3H3 |
| InChIKey | ICCQGSFZYMKHKR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |