C13H21Cl2NO2 — CID 3027654
2-[[1-(3-chlorophenyl)-1-hydroxypropan-2-yl]amino]-2-methylpropan-1-ol;hydrochloride (PubChem CID 3027654) has the molecular formula C13H21Cl2NO2 and a molecular weight of 294.22 g/mol. Its IUPAC name is 2-[[1-(3-chlorophenyl)-1-hydroxypropan-2-yl]amino]-2-methylpropan-1-ol;hydrochloride.
| Compound Name | 2-[[1-(3-chlorophenyl)-1-hydroxypropan-2-yl]amino]-2-methylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 3027654 |
| Molecular Formula | C13H21Cl2NO2 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-[[1-(3-chlorophenyl)-1-hydroxypropan-2-yl]amino]-2-methylpropan-1-ol;hydrochloride |
| SMILES | CC(NC(C)(C)CO)C(O)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C13H20ClNO2.ClH/c1-9(15-13(2,3)8-16)12(17)10-5-4-6-11(14)7-10;/h4-7,9,12,15-17H,8H2,1-3H3;1H |
| InChIKey | XVNHCJQYNGGYTC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |