C13H20ClNO — CID 45039021
(1S,2R)-1-(3-chlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-ol (PubChem CID 45039021) has the molecular formula C13H20ClNO and a molecular weight of 250.82 g/mol. Its IUPAC name is (1S,2R)-1-(3-chlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-ol.
| Compound Name | (1S,2R)-1-(3-chlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 45039021 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 250.82 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (1S,2R)-1-(3-chlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-ol |
| SMILES | [2H]C([2H])([2H])C(N[C@H](C)[C@@H](O)c1cccc(Cl)c1)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H20ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,12,15-16H,1-4H3/t9-,12-/m1/s1/i2D3,3D3,4D3 |
| InChIKey | NDPTTXIBLSWNSF-WSBYFTHXSA-N |
| XLogP | 3.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |