C14H20ClNO — CID 82088364
3-(3-chlorophenyl)-N,4,4-trimethylpentanamide (PubChem CID 82088364) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N,4,4-trimethylpentanamide.
| Compound Name | 3-(3-chlorophenyl)-N,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 82088364 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-(3-chlorophenyl)-N,4,4-trimethylpentanamide |
| SMILES | CNC(=O)CC(c1cccc(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C14H20ClNO/c1-14(2,3)12(9-13(17)16-4)10-6-5-7-11(15)8-10/h5-8,12H,9H2,1-4H3,(H,16,17) |
| InChIKey | KGNXZRNEAYULEH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |