C16H15Cl2NOS — CID 118654886
2-[bis(3-chlorophenyl)methylsulfanyl]-N-methylacetamide (PubChem CID 118654886) has the molecular formula C16H15Cl2NOS and a molecular weight of 340.28 g/mol. Its IUPAC name is 2-[bis(3-chlorophenyl)methylsulfanyl]-N-methylacetamide.
| Compound Name | 2-[bis(3-chlorophenyl)methylsulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 118654886 |
| Molecular Formula | C16H15Cl2NOS |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-[bis(3-chlorophenyl)methylsulfanyl]-N-methylacetamide |
| SMILES | CNC(=O)CSC(c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NOS/c1-19-15(20)10-21-16(11-4-2-6-13(17)8-11)12-5-3-7-14(18)9-12/h2-9,16H,10H2,1H3,(H,19,20) |
| InChIKey | GAFDLCVCYQMXIO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |