C20H26Cl2N2O — CID 129153633
(4R,5S)-5-amino-4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)pentan-1-ol (PubChem CID 129153633) has the molecular formula C20H26Cl2N2O and a molecular weight of 381.35 g/mol. Its IUPAC name is (4R,5S)-5-amino-4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)pentan-1-ol.
| Compound Name | (4R,5S)-5-amino-4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 129153633 |
| Molecular Formula | C20H26Cl2N2O |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (4R,5S)-5-amino-4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-(propan-2-ylamino)pentan-1-ol |
| SMILES | CC(C)N[C@](N)(c1ccc(Cl)cc1)[C@H](CCCO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H26Cl2N2O/c1-14(2)24-20(23,16-8-10-17(21)11-9-16)19(7-4-12-25)15-5-3-6-18(22)13-15/h3,5-6,8-11,13-14,19,24-25H,4,7,12,23H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | MTBODAJBMPVKGF-WOJBJXKFSA-N |
| XLogP | 4.66 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|