C15H11Cl2N3O2 — CID 86726383
(2S)-2-azido-3,3-bis(4-chlorophenyl)propanoic acid (PubChem CID 86726383) has the molecular formula C15H11Cl2N3O2 and a molecular weight of 336.18 g/mol. Its IUPAC name is (2S)-2-azido-3,3-bis(4-chlorophenyl)propanoic acid.
| Compound Name | (2S)-2-azido-3,3-bis(4-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 86726383 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (2S)-2-azido-3,3-bis(4-chlorophenyl)propanoic acid |
| SMILES | [N-]=[N+]=N[C@H](C(=O)O)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11Cl2N3O2/c16-11-5-1-9(2-6-11)13(14(15(21)22)19-20-18)10-3-7-12(17)8-4-10/h1-8,13-14H,(H,21,22)/t14-/m0/s1 |
| InChIKey | XSRDVDUZXCSMAF-AWEZNQCLSA-N |
| XLogP | 4.89 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|