C13H12ClF2N3O2 — CID 118366849
(2R,3R)-2-azido-3-(4-chlorophenyl)-3-(3,3-difluorocyclobutyl)propanoic acid (PubChem CID 118366849) has the molecular formula C13H12ClF2N3O2 and a molecular weight of 315.71 g/mol. Its IUPAC name is (2R,3R)-2-azido-3-(4-chlorophenyl)-3-(3,3-difluorocyclobutyl)propanoic acid.
| Compound Name | (2R,3R)-2-azido-3-(4-chlorophenyl)-3-(3,3-difluorocyclobutyl)propanoic acid |
|---|---|
| PubChem CID | 118366849 |
| Molecular Formula | C13H12ClF2N3O2 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (2R,3R)-2-azido-3-(4-chlorophenyl)-3-(3,3-difluorocyclobutyl)propanoic acid |
| SMILES | [N-]=[N+]=N[C@@H](C(=O)O)[C@@H](c1ccc(Cl)cc1)C1CC(F)(F)C1 |
| InChI | InChI=1S/C13H12ClF2N3O2/c14-9-3-1-7(2-4-9)10(8-5-13(15,16)6-8)11(12(20)21)18-19-17/h1-4,8,10-11H,5-6H2,(H,20,21)/t10-,11+/m0/s1 |
| InChIKey | SSQNHVPTDMJBNM-WDEREUQCSA-N |
| XLogP | 4.23 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|