C16H11ClF3N3O3 — CID 90046627
(2S,3S)-2-azido-3-(4-chlorophenyl)-3-[3-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 90046627) has the molecular formula C16H11ClF3N3O3 and a molecular weight of 385.73 g/mol. Its IUPAC name is (2S,3S)-2-azido-3-(4-chlorophenyl)-3-[3-(trifluoromethoxy)phenyl]propanoic acid.
| Compound Name | (2S,3S)-2-azido-3-(4-chlorophenyl)-3-[3-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 90046627 |
| Molecular Formula | C16H11ClF3N3O3 |
| Molecular Weight | 385.73 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | (2S,3S)-2-azido-3-(4-chlorophenyl)-3-[3-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | [N-]=[N+]=N[C@H](C(=O)O)[C@@H](c1ccc(Cl)cc1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H11ClF3N3O3/c17-11-6-4-9(5-7-11)13(14(15(24)25)22-23-21)10-2-1-3-12(8-10)26-16(18,19)20/h1-8,13-14H,(H,24,25)/t13-,14-/m0/s1 |
| InChIKey | NJTOWXCDGMKWBD-KBPBESRZSA-N |
| XLogP | 5.13 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.73 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|