C15H10ClF3N4O2 — CID 126664510
(2S,3S)-2-azido-3-(4-chlorophenyl)-3-[6-(trifluoromethyl)-3-pyridinyl]propanoic acid (PubChem CID 126664510) has the molecular formula C15H10ClF3N4O2 and a molecular weight of 370.72 g/mol. Its IUPAC name is (2S,3S)-2-azido-3-(4-chlorophenyl)-3-[6-(trifluoromethyl)-3-pyridinyl]propanoic acid.
| Compound Name | (2S,3S)-2-azido-3-(4-chlorophenyl)-3-[6-(trifluoromethyl)-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 126664510 |
| Molecular Formula | C15H10ClF3N4O2 |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (2S,3S)-2-azido-3-(4-chlorophenyl)-3-[6-(trifluoromethyl)-3-pyridinyl]propanoic acid |
| SMILES | [N-]=[N+]=N[C@H](C(=O)O)[C@@H](c1ccc(Cl)cc1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C15H10ClF3N4O2/c16-10-4-1-8(2-5-10)12(13(14(24)25)22-23-20)9-3-6-11(21-7-9)15(17,18)19/h1-7,12-13H,(H,24,25)/t12-,13-/m0/s1 |
| InChIKey | LRBDVMHCKPZOSB-STQMWFEESA-N |
| XLogP | 4.65 |
| TPSA | 98.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|