C16H20F3NO3 — CID 176929830
1-[[4-(5,5,5-trifluoropentoxy)phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 176929830) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 1-[[4-(5,5,5-trifluoropentoxy)phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-(5,5,5-trifluoropentoxy)phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 176929830 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[[4-(5,5,5-trifluoropentoxy)phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc(OCCCCC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H20F3NO3/c17-16(18,19)7-1-2-8-23-14-5-3-12(4-6-14)9-20-10-13(11-20)15(21)22/h3-6,13H,1-2,7-11H2,(H,21,22) |
| InChIKey | LYONNBBGTZIKIC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|