C21H26F3NO3 — CID 155440893
1-[[3-ethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid (PubChem CID 155440893) has the molecular formula C21H26F3NO3 and a molecular weight of 397.44 g/mol. Its IUPAC name is 1-[[3-ethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[3-ethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155440893 |
| Molecular Formula | C21H26F3NO3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-[[3-ethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
| SMILES | CCC1Cc2cc(OCCCC(F)(F)F)ccc2C=C1CN1CC(C(=O)O)C1 |
| InChI | InChI=1S/C21H26F3NO3/c1-2-14-8-16-10-19(28-7-3-6-21(22,23)24)5-4-15(16)9-17(14)11-25-12-18(13-25)20(26)27/h4-5,9-10,14,18H,2-3,6-8,11-13H2,1H3,(H,26,27) |
| InChIKey | NNRRMCDTFBOPTD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|