C20H26N2O — CID 139435137
1-[[(3R)-6-butoxy-3-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carbonitrile (PubChem CID 139435137) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[[(3R)-6-butoxy-3-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carbonitrile.
| Compound Name | 1-[[(3R)-6-butoxy-3-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 139435137 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-[[(3R)-6-butoxy-3-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carbonitrile |
| SMILES | CCCCOc1ccc2c(c1)C[C@@H](C)C(CN1CC(C#N)C1)=C2 |
| InChI | InChI=1S/C20H26N2O/c1-3-4-7-23-20-6-5-17-9-19(15(2)8-18(17)10-20)14-22-12-16(11-21)13-22/h5-6,9-10,15-16H,3-4,7-8,12-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | BENJVHYYJAKVMB-OAHLLOKOSA-N |
| XLogP | 3.90 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|