C16H22O — CID 175701230
(2S)-2-methyl-7-pentoxy-1,2-dihydronaphthalene (PubChem CID 175701230) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (2S)-2-methyl-7-pentoxy-1,2-dihydronaphthalene.
| Compound Name | (2S)-2-methyl-7-pentoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 175701230 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2S)-2-methyl-7-pentoxy-1,2-dihydronaphthalene |
| SMILES | CCCCCOc1ccc2c(c1)C[C@H](C)C=C2 |
| InChI | InChI=1S/C16H22O/c1-3-4-5-10-17-16-9-8-14-7-6-13(2)11-15(14)12-16/h6-9,12-13H,3-5,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | XZOXGJYDFYKVGK-CYBMUJFWSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|