C15H17F3O — CID 155755695
(2S)-2-methyl-7-(4,4,4-trifluorobutoxy)-1,2-dihydronaphthalene (PubChem CID 155755695) has the molecular formula C15H17F3O and a molecular weight of 270.29 g/mol. Its IUPAC name is (2S)-2-methyl-7-(4,4,4-trifluorobutoxy)-1,2-dihydronaphthalene.
| Compound Name | (2S)-2-methyl-7-(4,4,4-trifluorobutoxy)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 155755695 |
| Molecular Formula | C15H17F3O |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2S)-2-methyl-7-(4,4,4-trifluorobutoxy)-1,2-dihydronaphthalene |
| SMILES | C[C@@H]1C=Cc2ccc(OCCCC(F)(F)F)cc2C1 |
| InChI | InChI=1S/C15H17F3O/c1-11-3-4-12-5-6-14(10-13(12)9-11)19-8-2-7-15(16,17)18/h3-6,10-11H,2,7-9H2,1H3/t11-/m1/s1 |
| InChIKey | BJFHAMPBKUNJQE-LLVKDONJSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|