C20H30O3 — CID 163936783
7-heptoxy-3-(2-methoxyethoxy)-1,2-dihydronaphthalene (PubChem CID 163936783) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 7-heptoxy-3-(2-methoxyethoxy)-1,2-dihydronaphthalene.
| Compound Name | 7-heptoxy-3-(2-methoxyethoxy)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 163936783 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 7-heptoxy-3-(2-methoxyethoxy)-1,2-dihydronaphthalene |
| SMILES | CCCCCCCOc1ccc2c(c1)CCC(OCCOC)=C2 |
| InChI | InChI=1S/C20H30O3/c1-3-4-5-6-7-12-22-19-10-8-18-16-20(23-14-13-21-2)11-9-17(18)15-19/h8,10,15-16H,3-7,9,11-14H2,1-2H3 |
| InChIKey | RNMJJIUKGOZFKG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|