C16H22N2O3 — CID 19788833
1-[(6-butoxy-3,4-dihydronaphthalen-2-yl)methyl]-1-hydroxyurea (PubChem CID 19788833) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-[(6-butoxy-3,4-dihydronaphthalen-2-yl)methyl]-1-hydroxyurea.
| Compound Name | 1-[(6-butoxy-3,4-dihydronaphthalen-2-yl)methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 19788833 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-[(6-butoxy-3,4-dihydronaphthalen-2-yl)methyl]-1-hydroxyurea |
| SMILES | CCCCOc1ccc2c(c1)CCC(CN(O)C(N)=O)=C2 |
| InChI | InChI=1S/C16H22N2O3/c1-2-3-8-21-15-7-6-13-9-12(4-5-14(13)10-15)11-18(20)16(17)19/h6-7,9-10,20H,2-5,8,11H2,1H3,(H2,17,19) |
| InChIKey | YVAGQZPFZDJXRB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|