C22H30N4O6 — CID 54418481
1-[[4-[6-[4-[[carbamoyl(hydroxy)amino]methyl]phenoxy]hexoxy]phenyl]methyl]-1-hydroxyurea (PubChem CID 54418481) has the molecular formula C22H30N4O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is 1-[[4-[6-[4-[[carbamoyl(hydroxy)amino]methyl]phenoxy]hexoxy]phenyl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[4-[6-[4-[[carbamoyl(hydroxy)amino]methyl]phenoxy]hexoxy]phenyl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 54418481 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-[[4-[6-[4-[[carbamoyl(hydroxy)amino]methyl]phenoxy]hexoxy]phenyl]methyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)Cc1ccc(OCCCCCCOc2ccc(CN(O)C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C22H30N4O6/c23-21(27)25(29)15-17-5-9-19(10-6-17)31-13-3-1-2-4-14-32-20-11-7-18(8-12-20)16-26(30)22(24)28/h5-12,29-30H,1-4,13-16H2,(H2,23,27)(H2,24,28) |
| InChIKey | VZCVXRDKDXGQBP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|