C22H21ClN4O6 — CID 54414474
1-[[4-[3-[4-[[carbamoyl(hydroxy)amino]methyl]phenoxy]-5-chlorophenoxy]phenyl]methyl]-1-hydroxyurea (PubChem CID 54414474) has the molecular formula C22H21ClN4O6 and a molecular weight of 472.89 g/mol. Its IUPAC name is 1-[[4-[3-[4-[[carbamoyl(hydroxy)amino]methyl]phenoxy]-5-chlorophenoxy]phenyl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[4-[3-[4-[[carbamoyl(hydroxy)amino]methyl]phenoxy]-5-chlorophenoxy]phenyl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 54414474 |
| Molecular Formula | C22H21ClN4O6 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 1-[[4-[3-[4-[[carbamoyl(hydroxy)amino]methyl]phenoxy]-5-chlorophenoxy]phenyl]methyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)Cc1ccc(Oc2cc(Cl)cc(Oc3ccc(CN(O)C(N)=O)cc3)c2)cc1 |
| InChI | InChI=1S/C22H21ClN4O6/c23-16-9-19(32-17-5-1-14(2-6-17)12-26(30)21(24)28)11-20(10-16)33-18-7-3-15(4-8-18)13-27(31)22(25)29/h1-11,30-31H,12-13H2,(H2,24,28)(H2,25,29) |
| InChIKey | VWKUFQJTQWXHCI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|