C8H9ClN2O2 — CID 134087459
1-[(3-chlorophenyl)methyl]-1-hydroxyurea (PubChem CID 134087459) has the molecular formula C8H9ClN2O2 and a molecular weight of 200.63 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-1-hydroxyurea.
| Compound Name | 1-[(3-chlorophenyl)methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 134087459 |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C8H9ClN2O2/c9-7-3-1-2-6(4-7)5-11(13)8(10)12/h1-4,13H,5H2,(H2,10,12) |
| InChIKey | CLIWCYFLZCQNPE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|