C11H16ClN3O2 — CID 66337674
hydrazinyl 3-[(3-chlorophenyl)methyl-methylamino]propanoate (PubChem CID 66337674) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is hydrazinyl 3-[(3-chlorophenyl)methyl-methylamino]propanoate.
| Compound Name | hydrazinyl 3-[(3-chlorophenyl)methyl-methylamino]propanoate |
|---|---|
| PubChem CID | 66337674 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | hydrazinyl 3-[(3-chlorophenyl)methyl-methylamino]propanoate |
| SMILES | CN(CCC(=O)ONN)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H16ClN3O2/c1-15(6-5-11(16)17-14-13)8-9-3-2-4-10(12)7-9/h2-4,7,14H,5-6,8,13H2,1H3 |
| InChIKey | XPLOTSCXVVKTMD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|