C17H15ClN2O3 — CID 19018192
1-[[4-[3-(3-chlorophenyl)-1-hydroxyprop-2-ynyl]phenyl]methyl]-1-hydroxyurea (PubChem CID 19018192) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is 1-[[4-[3-(3-chlorophenyl)-1-hydroxyprop-2-ynyl]phenyl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[4-[3-(3-chlorophenyl)-1-hydroxyprop-2-ynyl]phenyl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 19018192 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-[[4-[3-(3-chlorophenyl)-1-hydroxyprop-2-ynyl]phenyl]methyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)Cc1ccc(C(O)C#Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H15ClN2O3/c18-15-3-1-2-12(10-15)6-9-16(21)14-7-4-13(5-8-14)11-20(23)17(19)22/h1-5,7-8,10,16,21,23H,11H2,(H2,19,22) |
| InChIKey | OGEKJJMPFQGWMK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|