C11H11ClN2O — CID 114777655
2-amino-N-[3-(3-chlorophenyl)prop-2-ynyl]acetamide (PubChem CID 114777655) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 2-amino-N-[3-(3-chlorophenyl)prop-2-ynyl]acetamide.
| Compound Name | 2-amino-N-[3-(3-chlorophenyl)prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 114777655 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-amino-N-[3-(3-chlorophenyl)prop-2-ynyl]acetamide |
| SMILES | NCC(=O)NCC#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2O/c12-10-5-1-3-9(7-10)4-2-6-14-11(15)8-13/h1,3,5,7H,6,8,13H2,(H,14,15) |
| InChIKey | IPVYYYWJYOJHLY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|