C19H18ClNO — CID 90548466
N-[3-(3-chlorophenyl)prop-2-ynyl]-4-phenylbutanamide (PubChem CID 90548466) has the molecular formula C19H18ClNO and a molecular weight of 311.81 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)prop-2-ynyl]-4-phenylbutanamide.
| Compound Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 90548466 |
| Molecular Formula | C19H18ClNO |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)NCC#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18ClNO/c20-18-12-4-10-17(15-18)11-6-14-21-19(22)13-5-9-16-7-2-1-3-8-16/h1-4,7-8,10,12,15H,5,9,13-14H2,(H,21,22) |
| InChIKey | ZMCWFYSMIHHJMX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|