C16H18ClNO — CID 90548372
N-[3-(3-chlorophenyl)prop-2-ynyl]-2-cyclopentylacetamide (PubChem CID 90548372) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)prop-2-ynyl]-2-cyclopentylacetamide.
| Compound Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 90548372 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-2-cyclopentylacetamide |
| SMILES | O=C(CC1CCCC1)NCC#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18ClNO/c17-15-9-3-7-13(11-15)8-4-10-18-16(19)12-14-5-1-2-6-14/h3,7,9,11,14H,1-2,5-6,10,12H2,(H,18,19) |
| InChIKey | BGIVZAZSLGKKJG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|