C18H16ClNOS — CID 58227437
1-[2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-2-cyclopentylethanone (PubChem CID 58227437) has the molecular formula C18H16ClNOS and a molecular weight of 329.85 g/mol. Its IUPAC name is 1-[2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-2-cyclopentylethanone.
| Compound Name | 1-[2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-2-cyclopentylethanone |
|---|---|
| PubChem CID | 58227437 |
| Molecular Formula | C18H16ClNOS |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-[2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-2-cyclopentylethanone |
| SMILES | O=C(CC1CCCC1)c1cnc(C#Cc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C18H16ClNOS/c19-15-7-3-6-14(10-15)8-9-18-20-12-17(22-18)16(21)11-13-4-1-2-5-13/h3,6-7,10,12-13H,1-2,4-5,11H2 |
| InChIKey | AYIGIPXVIVJRFR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|