C18H16ClNO2S — CID 58227495
[2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-(4-hydroxycyclohexyl)methanone (PubChem CID 58227495) has the molecular formula C18H16ClNO2S and a molecular weight of 345.85 g/mol. Its IUPAC name is [2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-(4-hydroxycyclohexyl)methanone.
| Compound Name | [2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-(4-hydroxycyclohexyl)methanone |
|---|---|
| PubChem CID | 58227495 |
| Molecular Formula | C18H16ClNO2S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | [2-[2-(3-chlorophenyl)ethynyl]-1,3-thiazol-5-yl]-(4-hydroxycyclohexyl)methanone |
| SMILES | O=C(c1cnc(C#Cc2cccc(Cl)c2)s1)C1CCC(O)CC1 |
| InChI | InChI=1S/C18H16ClNO2S/c19-14-3-1-2-12(10-14)4-9-17-20-11-16(23-17)18(22)13-5-7-15(21)8-6-13/h1-3,10-11,13,15,21H,5-8H2 |
| InChIKey | ZPGTVNKPRXSMCE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|